ChemikalieSymboleH- / EUH- / P-SätzeMenge
Daten von: Kein Sicherheitsdatenblatt verfügbar.

9,10-Di-n-butylanthracen, C22H26

Synonyme: 9,10-Dibutylanthracen
M: 290.44 g/mol

CAS-Nr.: 1624-34-6

Karzinogenität-Kat.: ?
Keimzellmutagenität-Kat.: ?
Reproduktionstoxizität-Kat.: ?
Sensibillisierend (allgemein): ?
WGK: 3

GHS10 - Unbekannte Eigenschaften

(Gefahr)

Unbekannte Eigenschaften.

Kein Sicherheitsdatenblatt verfügbar.

 

 

Identifizierung

InChI: InChI=1S/C22H26/c1-3-5-11-17-19-13-7-9-15-21(19)18(12-6-4-2)22-16-10-8-14-20(17)22/h7-10,13-16H,3-6,11-12H2,1-2H3

InChI Key: XLTRLRBXMJBVPL-UHFFFAOYSA-N

Canonical SMILES: CCCCC1=C2C=CC=CC2=C(C3=CC=CC=C31)CCCC

PubChem: 605822

 

Foren-Code

[B]xx 9,10-Di-[I]n[/I]-butylanthracen[/B], C[sub]22[/sub]H[sub]26[/sub]

CAS-Nr.: 1624-34-6

[img]https://www.chem-page.de/images/gefahrensymbole/ghs10_unbekannt_50.png[/img]

Signalwort: (Gefahr)

Karzinogenität: ?

Keimzellmutagenität: ?

Reproduktionstoxizität: ?

Sensibilisieren (allgemein): ?

WGK: 3

Unbekannte Eigenschaften. Es liegt kein Sicherheitsdatenblatt vor.

 

Zum Seitenanfang