ChemikalieSymboleH- / EUH- / P-SätzeMenge
Daten von: Kein Sicherheitsdatenblatt verfügbar.

9,10-Diphenyl-9,10-dihydro-anthracen, C26H20

M: 332.44 g/mol

CAS-Nr.: 803-58-7

Karzinogenität-Kat.: ?
Keimzellmutagenität-Kat.: ?
Reproduktionstoxizität-Kat.: ?
Sensibillisierend (allgemein): ?
WGK: 3

GHS10 - Unbekannte Eigenschaften

(Gefahr)

Unbekannte Eigenschaften.

Kein Sicherheitsdatenblatt verfügbar.

 

 

Identifizierung

InChI: InChI=1S/C26H20/c1-3-11-19(12-4-1)25-21-15-7-9-17-23(21)26(20-13-5-2-6-14-20)24-18-10-8-16-22(24)25/h1-18,25-26H

InChI Key: LPEKXGHZXXJFSN-UHFFFAOYSA-N

Canonical SMILES: C1=CC=C(C=C1)C2C3=CC=CC=C3C(C4=CC=CC=C24)C5=CC=CC=C5

PubChem: 630440

 

Foren-Code

[B]xx 9,10-Diphenyl-9,10-dihydro-anthracen[/B], C[sub]26[/sub]H[sub]20[/sub]

CAS-Nr.: 803-58-7

[img]https://www.chem-page.de/images/gefahrensymbole/ghs10_unbekannt_50.png[/img]

Signalwort: (Gefahr)

Karzinogenität: ?

Keimzellmutagenität: ?

Reproduktionstoxizität: ?

Sensibilisieren (allgemein): ?

WGK: 3

Unbekannte Eigenschaften. Es liegt kein Sicherheitsdatenblatt vor.

 

Zum Seitenanfang