ChemikalieSymboleH- / EUH- / P-SätzeMenge

Violanthren, C34H20

M: 428.52 g/mol

CAS-Nr.: 81-31-2

Karzinogenität-Kat.: ?
Keimzellmutagenität-Kat.: ?
Reproduktionstoxizität-Kat.: ?
Sensibillisierend (allgemein): ?
WGK: 3

GHS10 - Unbekannte Eigenschaften

(Gefahr)

Unbekannte Eigenschaften.

Es liegt kein Sicherheitsdatenblatt vor.

 

 

Identifizierung

InChI: InChI=1S/C34H20/c1-3-7-23-19(5-1)17-21-9-11-27-28-12-10-22-18-20-6-2-4-8-24(20)26-14-16-30(34(28)32(22)26)29-15-13-25(23)31(21)33(27)29/h1-16H,17-18H2

InChI Key: JAIHDOVRCZNXDU-UHFFFAOYSA-N

Canonical SMILES: C1C2=CC=CC=C2C3=C4C1=CC=C5C4=C(C=C3)C6=C7C5=CC=C8C7=C(C=C6)C9=CC=CC=C9C8

PubChem: 135962

 

Entsorgungshinweise

Restmengen und nicht wieder verwertbare Lösungen einem anerkannten Entsorgungsunternehmen zuführen.

 

Foren-Code

[B]xx Violanthren[/B], C[sub]34[/sub]H[sub]20[/sub]O[sub]2[/sub]

CAS-Nr.: 81-31-2

[img]https://www.chem-page.de/images/gefahrensymbole/ghs10_unbekannt_50.png[/img]

Signalwort: (Gefahr)

Karzinogenität: ?

Keimzellmutagenität: ?

Reproduktionstoxizität: ?

Sensibilisieren (allgemein): ?

WGK: 3

Unbekannte Eigenschaften. Es liegt kein Sicherheitsdatenblatt vor.

 

Zum Seitenanfang